
Catalog Number	AR005NQK
Chemical Name	Benzenesulfonylchloride, 3-acetyl-
CAS Number	73035-16-2
Molecular Formula	C8H7ClO3S
Molecular Weight	218.6574
MDL Number	MFCD03424979
SMILES	CC(=O)c1cccc(c1)S(=O)(=O)Cl

3-Acetylbenzenesulfonyl chloride is a versatile compound widely used in chemical synthesis for its unique properties and reactivity. This compound serves as a valuable acylating agent, allowing for the introduction of the acetyl group onto various nucleophilic substrates. In organic synthesis, 3-Acetylbenzenesulfonyl chloride is particularly employed in the preparation of aryl acetyl derivatives, which are important building blocks in the synthesis of pharmaceuticals, agrochemicals, and materials.Additionally, 3-Acetylbenzenesulfonyl chloride is utilized in the development of novel dyes and pigments due to its ability to modify aromatic compounds with both acetyl and sulfonyl functionalities. This compound's selective reactivity makes it a crucial tool in the modification of aromatic systems, enabling chemists to fine-tune the properties of molecules for specific applications.Furthermore, 3-Acetylbenzenesulfonyl chloride plays a vital role in the synthesis of various heterocyclic compounds, including sulfonamide derivatives, which are important in medicinal chemistry. By enabling the introduction of acetyl and sulfonyl groups onto nucleophilic sites, this compound facilitates the creation of structurally diverse molecules with tailored properties, expanding the scope of chemical synthesis in both academic research and industrial applications.