
Catalog Number	AR00I3UR
Chemical Name	Bromo-PEG4-azide
CAS Number	1951439-37-4
Molecular Formula	C10H20BrN3O4
Molecular Weight	326.18750000000006
MDL Number	MFCD27977494
SMILES	BrCCOCCOCCOCCOCCN=[N+]=[N-]

Bromo-PEG4-azide is a versatile compound widely employed in chemical synthesis for efficient modification of biomolecules and other organic compounds. Its primary application lies in click chemistry reactions, where it serves as a valuable tool for specific and bioorthogonal labeling. This compound can selectively react with terminal alkynes or strained cyclooctynes through copper-catalyzed azide-alkyne cycloaddition (CuAAC) or copper-free strain-promoted azide-alkyne cycloaddition (SPAAC) reactions, respectively. By introducing Bromo-PEG4-azide into the target molecule, researchers can easily conjugate a variety of functional groups or probes for fluorescent tagging, drug delivery systems, or biomolecular engineering. Additionally, the long PEG4 linker enhances the solubility and biocompatibility of the compound, making it a preferred choice in bioconjugation strategies. Overall, Bromo-PEG4-azide plays a crucial role in the development of advanced materials and bioconjugates for various research and industrial applications.