
Catalog Number	AR00G3HD
Chemical Name	(3β,5α,22β,25S)-Spirosolan-3-ol
CAS Number	77-59-8
Molecular Formula	C27H45NO2
Molecular Weight	415.6517
MDL Number	MFCD00075644
SMILES	C[C@H]1CC[C@]2(NC1)O[C@@H]1[C@H]([C@@H]2C)[C@@]2([C@@H](C1)[C@@H]1CC[C@@H]3[C@]([C@H]1CC2)(C)CC[C@@H](C3)O)C

Tomatidine is a naturally occurring steroidal alkaloid found in certain plant species, such as green tomatoes. In chemical synthesis, Tomatidine is utilized as a valuable starting material for the production of various pharmaceutical compounds and synthetic intermediates. Due to its unique chemical structure and reactivity, Tomatidine can serve as a key building block in the synthesis of bioactive molecules, including steroidal drugs and other pharmacological agents. Additionally, Tomatidine has been studied for its potential therapeutic applications in the fields of medicine and biochemistry.