
Catalog Number	AR003H96
Chemical Name	2-Aminotetralin-2-carboxylic Acid
CAS Number	74444-77-2
Molecular Formula	C11H13NO2
Molecular Weight	191.22642
MDL Number	MFCD07371369
SMILES	OC(=O)C1(N)CCc2c(C1)cccc2

2-Aminotetralin-2-carboxylic Acid, also known as ATCA, is a versatile compound that finds valuable application in chemical synthesis. As a key building block in organic chemistry, ATCA serves as a crucial intermediate in the production of various pharmaceuticals and fine chemicals. One significant use of ATCA is in the synthesis of serotonin receptor agonists and antagonists, which are important in the development of medications targeting neurological disorders, such as depression and anxiety. By incorporating ATCA as a precursor in these synthetic routes, chemists can efficiently access a wide range of bioactive molecules with therapeutic potential.Moreover, ATCA plays a pivotal role in the preparation of diverse heterocyclic compounds due to its unique structure and reactivity. Its inherent flexibility in forming bonds with different functional groups makes it an indispensable tool for the creation of complex molecular structures in medicinal chemistry and drug discovery.Overall, the application of 2-Aminotetralin-2-carboxylic Acid in chemical synthesis underscores its significance in advancing the field of pharmaceutical science and underscores its value as a versatile and indispensable reagent for synthetic organic chemists.