
Catalog Number	AR006617
Chemical Name	Retinyl Propionate
CAS Number	7069-42-3
Molecular Formula	C23H34O2
Molecular Weight	342.51486
MDL Number	MFCD00129785
SMILES	CCC(=O)OCC=C(C=CC=C(C=CC1=C(C)CCCC1(C)C)C)C

In chemical synthesis, (2E,4E,6E,8E)-3,7-Dimethyl-9-(2,6,6-trimethylcyclohex-1-en-1-yl)nona-2,4,6,8-tetraen-1-yl propionate can serve as a versatile building block for creating complex organic molecules. Its unique structure, featuring multiple conjugated double bonds and a cyclohexene ring, lends itself to various synthetic pathways for the formation of intricate chemical structures. This compound can be used as a precursor in the synthesis of natural products, pharmaceuticals, and functional materials, where its specific functional groups and stereochemistry play a crucial role in determining the final product's properties and reactivity. Additionally, the presence of the propionate ester moiety provides opportunities for further derivatization and modification, expanding the potential applications of this compound in organic chemistry research and applied synthesis.

Retinyl Propionate

7069-42-3

Product Details