
Catalog Number	AR005LHB
Chemical Name	Deoxynojirimycin Tetrabenzyl Ether
CAS Number	69567-11-9
Molecular Formula	C34H37NO4
Molecular Weight	523.6619
MDL Number	MFCD11113146
SMILES	c1ccc(cc1)CO[C@@H]1[C@@H](COCc2ccccc2)NC[C@@H]([C@H]1OCc1ccccc1)OCc1ccccc1

3,4,5-Tris(benzyloxy)-2-((benzyloxy)methyl)piperidine is a versatile compound commonly employed in chemical synthesis as a powerful protecting group strategy. Due to its unique structure and reactivity, this compound is utilized for the selective protection of multiple functional groups on various organic molecules. In organic synthesis, the compound effectively shields sensitive functional groups from unwanted reactions or transformations during multi-step synthetic processes. Moreover, the compound can be selectively removed under specific conditions to unveil the original functional groups, enabling precise control over reaction pathways and increasing overall yield and purity of the desired product. Its strategic application as a protecting group contributes significantly to the efficiency and success of complex chemical syntheses by providing a reliable method for the temporary protection of key functional groups.

Deoxynojirimycin Tetrabenzyl Ether

69567-11-9

Product Details