
Catalog Number	AR003ANI
Chemical Name	(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-6-(Acetyloxy)-3-ethenyldodecahydro-5,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1H-naphtho[2,1-b]pyran-1-one
CAS Number	64657-21-2
Molecular Formula	C22H34O7
Molecular Weight	410.5011599999999
MDL Number	MFCD00078929
SMILES	C=C[C@@]1(C)CC(=O)[C@]2([C@@](O1)(C)[C@@H](O)[C@H]([C@@H]1[C@]2(C)[C@@H](O)CCC1(C)C)OC(=O)C)O

The compound (3R,4aR,5S,6S,6aS,10S,10aR,10bS)-6-(Acetyloxy)-3-ethenyldodecahydro-5,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1H-naphtho[2,1-b]pyran-1-one, also known as $name$, is a versatile molecule commonly used in chemical synthesis as a chiral building block. Its unique structure contains multiple stereocenters, providing an excellent substrate for creating complex organic compounds with specific stereochemical arrangements.$name$ is particularly valuable in the synthesis of natural products and pharmaceuticals where stereochemistry plays a crucial role in determining biological activity. By incorporating $name$ into synthetic pathways, chemists can control the stereochemistry of the final product, leading to compounds with enhanced potency, selectivity, and therapeutic properties.In addition to its application in chiral synthesis, $name$ can also serve as a key intermediate for the preparation of novel molecules with diverse functionalities. Its flexibility in functional group manipulations allows chemists to introduce various chemical modifications, expanding the scope of synthetic possibilities and enabling the creation of structurally intricate compounds for research and industrial purposes.Overall, the strategic utilization of $name$ in chemical synthesis empowers chemists to access a wide array of stereochemically defined molecules with significant implications in drug discovery, materials science, and other fields requiring precise control over molecular structure and properties.

(3R,4aR,5S,6S,6aS,10S,10aR,10bS)-6-(Acetyloxy)-3-ethenyldodecahydro-5,10,10b-trihydroxy-3,4a,7,7,10a-pentamethyl-1H-naphtho[2,1-b]pyran-1-one

64657-21-2

Product Details