
Catalog Number	AR01X5AD
Chemical Name	erythro-Hexonic acid, 2,4-dideoxy-3,5-O-(1-methylethylidene)-, 1,1-dimethylethyl ester
CAS Number	611205-80-2
Molecular Formula	C13H24O5
Molecular Weight	260.3267
MDL Number	MFCD08063915
SMILES	OC[C@@H]1C[C@H](CC(=O)OC(C)(C)C)OC(O1)(C)C

1,1-Dimethylethyl 2,4-dideoxy-3,5-O-(1-methylethylidene)-erythro-hexonate, commonly referred to as $name$, is a versatile compound widely utilized in chemical synthesis. In the realm of organic chemistry, $name$ plays a crucial role as a key building block in the synthesis of various pharmaceutical compounds. Its unique structure and reactivity allow it to participate in a wide range of chemical reactions, facilitating the creation of complex molecular structures with high precision. $name$ is particularly valuable in the synthesis of bioactive molecules and natural products due to its ability to serve as a precursor for diverse functional groups and stereochemical motifs. By incorporating $name$ into synthetic routes, chemists can efficiently access structurally diverse compounds with tailored properties for pharmaceutical applications.Additionally, $name$ can be employed in the development of novel materials, catalysts, and advanced organic syntheses. Its versatility and compatibility with various synthetic methodologies make it a valuable tool for researchers striving to explore new frontiers in chemical science and drug discovery.