
Catalog Number	AR003RPK
Chemical Name	Iodipamide
CAS Number	606-17-7
Molecular Formula	C20H14I6N2O6
Molecular Weight	1139.7618
MDL Number	MFCD00058983
SMILES	O=C(Nc1c(I)cc(c(c1I)C(=O)O)I)CCCCC(=O)Nc1c(I)cc(c(c1I)C(=O)O)I

In chemical synthesis, 3,3'-(Adipoyldiimino)-bis(2,4,6-triiodobenzoic acid) serves as a versatile building block with unique properties. This compound, commonly known as $name$, is utilized for its ability to participate in various reactions, including esterification, amidation, and condensation reactions. Its adipoyl diimide structure enables it to act as a bifunctional agent, facilitating the formation of complex molecules through the formation of amide bonds. Additionally, the triiodobenzoic acid moieties play a crucial role in introducing iodine atoms into target molecules, which can be advantageous for applications in imaging or iodination chemistry. By incorporating $name$ into synthetic pathways, chemists can access a diverse range of iodinated compounds with tailored properties for pharmaceuticals, materials science, and other fields.

Iodipamide

606-17-7

Product Details