
Catalog Number	AR003T0P
Chemical Name	N1-(4-Aminophenyl)benzene-1,4-diamine sulfate
CAS Number	53760-27-3
Molecular Formula	C12H15N3O4S
Molecular Weight	297.3302
MDL Number	MFCD08273733
SMILES	OS(=O)(=O)O.Nc1ccc(cc1)Nc1ccc(cc1)N

N1-(4-Aminophenyl)benzene-1,4-diamine sulfate is a vital reagent within the realm of chemical synthesis. This compound serves as a key building block in the creation of various organic compounds and complex molecules. It is commonly employed in the pharmaceutical industry, specifically in the synthesis of drugs and active pharmaceutical ingredients (APIs).With its unique structure and reactivity, N1-(4-Aminophenyl)benzene-1,4-diamine sulfate is utilized as a versatile intermediate in the preparation of dyes, pigments, and polymers. Its application extends to the field of materials science, where it is instrumental in the development of advanced materials with tailored properties.Moreover, in the realm of organic synthesis, this compound plays a crucial role in the construction of heterocyclic compounds and functionalized aromatic structures. Its ability to undergo various chemical transformations makes it a valuable tool for researchers and chemists aiming to design novel compounds with specific properties and functionalities.In conclusion, N1-(4-Aminophenyl)benzene-1,4-diamine sulfate is a multifaceted compound that finds widespread utility in chemical synthesis, enabling the creation of diverse molecules with applications across various industries.