
Catalog Number	AR00DETB
Chemical Name	\|N\|，\|N\|-Dimethyl-\|p\|-phenylenediamine sulfate salt
CAS Number	536-47-0
Molecular Formula	C8H14N2O4S
Molecular Weight	234.2728
MDL Number	MFCD00012992
SMILES	OS(=O)(=O)O.CN(c1ccc(cc1)N)C

N,N-Dimethyl-1,4-phenylenediamine sulfate is a versatile compound that finds extensive application in chemical synthesis processes. It serves as a valuable intermediate in the production of various organic compounds, particularly dyes and polymers. The compound's ability to facilitate the formation of complex molecular structures makes it a crucial component in the synthesis of high-performance materials. Additionally, N,N-Dimethyl-1,4-phenylenediamine sulfate exhibits notable properties that enable its use in the creation of specialty chemicals and pharmaceuticals. Its role in promoting specific chemical reactions and enhancing reaction pathways underscores its significance in advancing the field of synthetic chemistry.