
Catalog Number	AR003SZ6
Chemical Name	N-(3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl)pivalamide
CAS Number	532391-30-3
Molecular Formula	C16H25BN2O3
Molecular Weight	304.1923
MDL Number	MFCD06658997
SMILES	O=C(C(C)(C)C)Nc1ncccc1B1OC(C(O1)(C)C)(C)C

The compound N-(3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl)pivalamide plays a crucial role in chemical synthesis as a versatile building block. It is commonly utilized in Suzuki-Miyaura cross-coupling reactions, a powerful tool in organic chemistry that enables the formation of carbon-carbon bonds. By serving as a key ligand in this reaction, this compound facilitates the coupling of aryl halides with boronic acids or boronates, leading to the creation of complex organic molecules. Additionally, its unique structure containing both boron and amide functional groups imparts desirable properties to the synthesized products, making it a valuable tool for researchers and synthetic chemists in the development of new materials, pharmaceuticals, and agrochemicals.

N-(3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl)pivalamide

532391-30-3

Product Details