
Catalog Number	AR003TC9
Chemical Name	N-[Bis(4-methoxyphenyl)methylene]benzylamine
CAS Number	524-96-9
Molecular Formula	C22H21NO2
Molecular Weight	331.4076
MDL Number	MFCD00025824
SMILES	COc1ccc(cc1)C(=NCc1ccccc1)c1ccc(cc1)OC
NSC Number	32182

N-(Bis(4-methoxyphenyl)methylene)-1-phenylmethanamine, also known as $name$, is a versatile compound widely utilized in chemical synthesis, particularly in the field of organic chemistry. This compound serves as a key building block in the creation of various organic molecules due to its unique structural properties and reactivity.$name$ plays a crucial role as a reagent in the synthesis of complex organic compounds, where it acts as a valuable intermediate in multistep synthetic pathways. Its ability to undergo reactions such as condensation, reduction, and substitution makes it a valuable tool for chemists seeking to construct intricate molecular structures.In chemical synthesis, $name$ is commonly employed in the preparation of pharmaceuticals, agrochemicals, and other fine chemicals. Its application extends to the creation of functional materials, dyes, and specialty chemicals, where its structural features contribute to the formation of diverse products with specific properties and functionalities.Overall, the use of N-(Bis(4-methoxyphenyl)methylene)-1-phenylmethanamine in chemical synthesis underscores its significance as a versatile and indispensable compound in the realm of organic chemistry. By enabling the efficient construction of complex organic molecules, $name$ facilitates the development of novel compounds with diverse applications in various industries and research fields.

N-[Bis(4-methoxyphenyl)methylene]benzylamine

524-96-9

Product Details