
Catalog Number	AR003N1B
Chemical Name	5-Amino-1-(3-chlorphenyl)-1H-pyrazol-4-carbonitril
CAS Number	51516-68-8
Molecular Formula	C10H7ClN4
Molecular Weight	218.6424
MDL Number	MFCD00128298
SMILES	N#Cc1cnn(c1N)c1cccc(c1)Cl

5-Amino-1-(3-chlorophenyl)-1H-pyrazole-4-carbonitrile is a versatile compound used in various chemical synthesis processes. It serves as a key building block for the creation of novel molecules with diverse applications. In organic synthesis, this compound acts as a crucial intermediate in the formation of biologically active compounds and pharmaceutical ingredients. Its unique structure and reactivity make it valuable in the development of new materials and compounds with specialized functions. Additionally, 5-Amino-1-(3-chlorophenyl)-1H-pyrazole-4-carbonitrile is employed in medicinal chemistry for the synthesis of potential drug candidates through the modification of its chemical structure. Its role in chemical synthesis extends to the fields of agrochemicals, materials science, and academic research, where its versatile nature contributes to the advancement of various industries and scientific disciplines.