
Catalog Number	AR00IMHE
Chemical Name	Dimethyl D-Tartrate
CAS Number	5057-96-5
Molecular Formula	C6H10O6
Molecular Weight	178.14
MDL Number	MFCD00063813
SMILES	COC(=O)[C@H]([C@H](C(=O)OC)O)O

Dimethyl meso-tartrate is a versatile compound widely utilized in chemical synthesis, particularly in the production of chiral molecules. Its unique stereochemistry and functional groups make it a valuable building block for various organic reactions. This compound is commonly employed as a starting material in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals. Its ability to undergo selective transformations enables chemists to access a diverse array of complex molecules with high enantiomeric purity. Additionally, Dimethyl meso-tartrate serves as a key intermediate in the preparation of efficient chiral ligands for asymmetric catalysis, playing a crucial role in the development of new synthetic methodologies. Its widespread application in modern organic synthesis highlights its importance in advancing the field of chemical science.