
Catalog Number	AR006WN8
Chemical Name	β-Tocotrienol
CAS Number	490-23-3
Molecular Formula	C28H42O2
Molecular Weight	410.6319
MDL Number	MFCD09264634
SMILES	C/C(=C\CC[C@]1(C)CCc2c(O1)c(C)cc(c2C)O)/CC/C=C(/CC/C=C(\C)/C)\C

Beta-Tocotrienol, a form of vitamin E, has gained recognition for its versatile applications in chemical synthesis. This compound serves as a valuable reagent in organic chemistry due to its unique properties and reactivity. In particular, beta-Tocotrienol is widely utilized as a powerful antioxidant, making it an excellent candidate for protecting sensitive chemical reactions from unwanted side reactions or degradation. Its ability to scavenge free radicals and stabilize reactive intermediates enables it to act as a stabilizing agent in various synthesis processes.Moreover, beta-Tocotrienol exhibits interesting chelating properties that allow it to coordinate with metal ions, serving as a chelating agent in metal-catalyzed reactions. This capability enhances the selectivity and efficiency of metal-mediated transformations, enabling the synthesis of complex molecules with high precision. In addition, beta-Tocotrienol can act as a reducing agent in certain reactions, facilitating the conversion of functional groups and enabling the synthesis of diverse chemical compounds.Overall, the application of beta-Tocotrienol in chemical synthesis offers a range of benefits, including improved reaction efficiency, enhanced selectivity, and increased product yields. Its versatile reactivity and unique properties make it a valuable tool for chemists seeking to develop new synthetic routes and access novel chemical structures.