
Catalog Number	AR0039JN
Chemical Name	2,2-Dimethoxy-2-phenylacetophenone
CAS Number	24650-42-8
Molecular Formula	C16H16O3
Molecular Weight	256.2964
MDL Number	MFCD00008475
SMILES	COC(C(=O)c1ccccc1)(c1ccccc1)OC

2,2-Dimethoxy-2-phenylacetophenone, commonly known as DMAPA, is a versatile compound widely used in chemical synthesis due to its unique properties. In organic chemistry, this compound is predominantly employed as a photoinitiator in the fabrication of polymers, resins, and coatings. When exposed to light of a specific wavelength, DMAPA undergoes a photochemical reaction that initiates the polymerization process, leading to the formation of cross-linked polymer networks.Furthermore, 2,2-Dimethoxy-2-phenylacetophenone serves as a valuable reagent in the synthesis of various organic compounds, including pharmaceutical intermediates, agrochemicals, and specialty chemicals. Its ability to undergo radical reactions and form carbon-carbon bonds makes it a key ingredient in the construction of complex molecular structures.Additionally, DMAPA finds applications in the production of adhesives, coatings, and dental materials where fast and efficient curing is essential. Its compatibility with a wide range of monomers and other additives makes it a popular choice for manufacturers seeking high-performance formulations in the polymer industry.Overall, the use of 2,2-Dimethoxy-2-phenylacetophenone as a photoinitiator and reagent in chemical synthesis plays a crucial role in enabling the creation of advanced materials with tailored properties and enhanced performance characteristics.

2,2-Dimethoxy-2-phenylacetophenone

24650-42-8

Product Details