
Catalog Number	AR01FOH7
Chemical Name	3-(4-fluorobenzylcarbamoyl)phenylboronic acid
CAS Number	874288-19-4
Molecular Formula	C14H13BFNO3
Molecular Weight	273.0673
MDL Number	MFCD28167474
SMILES	Fc1ccc(cc1)CNC(=O)c1cccc(c1)B(O)O

Boronic acid, B-[3-[[(4-fluorophenyl)methyl]amino]carbonyl]phenyl], is a versatile compound widely used in chemical synthesis. Its unique properties make it a valuable reagent in various reactions, particularly in Suzuki-Miyaura cross-coupling reactions. This boronic acid derivative serves as a key building block in the construction of complex organic molecules, allowing for the efficient formation of carbon-carbon bonds. By facilitating the coupling of aryl and heteroaryl compounds, this compound plays a crucial role in the synthesis of pharmaceuticals, agrochemicals, and materials with diverse applications.