
Catalog Number	AR01EIMR
Chemical Name	N-(3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetamide
CAS Number	844501-35-5
Molecular Formula	C14H19BFNO3
Molecular Weight	279.115
MDL Number	MFCD22494238
SMILES	CC(=O)Nc1ccc(c(c1)F)B1OC(C(O1)(C)C)(C)C

N-(3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetamide is a versatile compound widely used in chemical synthesis due to its unique reactivity and functional groups. This molecule serves as a key building block in the development of pharmaceuticals, agrochemicals, and materials science.In chemical synthesis, N-(3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetamide plays a crucial role as a coupling partner in cross-coupling reactions such as Suzuki-Miyaura coupling. The presence of the boron-containing moiety enables selective and efficient C-C bond formation, allowing for the construction of complex molecular structures with high regio- and stereoselectivity.Furthermore, the fluoro-substituted phenyl group provides opportunities for further functionalization through metal-catalyzed transformations, making N-(3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetamide a valuable tool for synthetic chemists aiming to introduce fluorine atoms into organic molecules.Overall, the strategic placement of functional groups in N-(3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetamide makes it a versatile and indispensable compound in the realm of modern chemical synthesis, facilitating the creation of diverse molecular architectures with synthetic efficiency and precision.