84364-89-6 | MFCD00151489 | β-D-Fructofuranose, 2,6-bis(dihydrogen phosphate); GO sodium salt (1:x);

Availability
Typically In Stock


Catalog Number	AR00GAV6
Chemical Name	β-D-Fructofuranose, 2,6-bis(dihydrogen phosphate); GO sodium salt (1:x);
CAS Number	84364-89-6
Molecular Formula	C6H14NaO12P2
Molecular Weight	363.1055
MDL Number	MFCD00151489
SMILES	OC[C@]1(O[C@@H]([C@H]([C@@H]1O)O)COP(=O)(O)O)OP(=O)(O)O.[Na]

In chemical synthesis, β-D-Fructofuranose, 2,6-bis(dihydrogen phosphate); GO sodium salt (1:x) serves as a valuable reagent for various reactions and transformations. This compound is particularly useful in the formation of complex carbohydrates through glycosylation reactions. Its unique structure and properties allow for selective formation of glycosidic bonds, enabling the synthesis of oligosaccharides and glycoconjugates with high efficiency and specificity. Additionally, this reagent can participate in phosphorylation reactions, serving as a phosphate donor to various substrates in the synthesis of phosphorylated compounds. Its versatility and compatibility with a wide range of reaction conditions make it a versatile tool for chemists working in the field of carbohydrate chemistry and chemical biology.