
Catalog Number	AR008NW0
Chemical Name	t-Butyl (2S)-2-[(Benzyloxycarbonylamino)]-4-hydroxybutyrate
CAS Number	78266-81-6
Molecular Formula	C16H23NO5
Molecular Weight	309.35751999999997
MDL Number	MFCD09840149
SMILES	OCC[C@@H](C(=O)OC(C)(C)C)NC(=O)OCc1ccccc1

In chemical synthesis, (S)-tert-Butyl 2-(((benzyloxy)carbonyl)amino)-4-hydroxybutanoate serves as a versatile building block with unique properties. This compound is commonly used as a protecting group for amino and hydroxyl functionalities due to its stability and ease of removal under mild conditions. Additionally, its tert-butyl ester moiety offers protection to the carboxylic acid group, allowing for selective reactions at other functional groups. The presence of the benzyloxycarbonyl (Cbz) group further enhances the compound's reactivity and selectivity in peptide synthesis and other organic transformations. These characteristics make (S)-tert-Butyl 2-(((benzyloxy)carbonyl)amino)-4-hydroxybutanoate a valuable tool in the construction of complex molecules in organic chemistry.