
Catalog Number	AR01QY3M
Chemical Name	Propanoic acid, 2-(phenylmethoxy)-, methyl ester, (2S)-
CAS Number	77287-11-7
Molecular Formula	C11H14O3
Molecular Weight	194.2271
MDL Number	MFCD01632536
SMILES	COC(=O)[C@@H](OCc1ccccc1)C

Methyl (2S)-2-(phenylmethoxy)propanoate is a versatile compound commonly employed in chemical synthesis as a reagent for the preparation of various organic molecules. With its unique structure, this compound plays a crucial role in the modification and functionalization of complex molecules in the laboratory setting. Specifically, the application of Methyl (2S)-2-(phenylmethoxy)propanoate in chemical synthesis involves its use as a key building block in the creation of pharmaceuticals, agrochemicals, and fine chemicals. In addition, its reactivity and compatibility with a wide range of reaction conditions make it an essential component in the development of novel organic compounds with diverse applications in the fields of medicine, agriculture, and materials science. By facilitating the synthesis of complex molecular structures, Methyl (2S)-2-(phenylmethoxy)propanoate enables chemists to explore new avenues in drug discovery, materials design, and chemical research.