
Catalog Number	AR01DUFG
Chemical Name	Acetic acid, [3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-,1,1-dimethylethyl ester
CAS Number	769968-18-5
Molecular Formula	C18H27BO5
Molecular Weight	334.215
MDL Number	MFCD30188007
SMILES	O=C(OC(C)(C)C)COc1cccc(c1)B1OC(C(O1)(C)C)(C)C

A versatile compound, 1,1-Dimethylethyl 2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetate plays a crucial role in chemical synthesis processes. Its application lies in its ability to serve as a key building block for the creation of complex organic molecules. By facilitating the introduction of functional groups and structural modifications, this compound enables chemists to efficiently generate a diverse range of novel compounds for various research and industrial applications. Its unique structure and reactivity make it a valuable tool in the toolbox of synthetic chemists, driving innovation and progress in the field.