
Catalog Number	AR00G903
Chemical Name	Unii-8163770L8p
CAS Number	769901-96-4
Molecular Formula	C23H25ClN4O4
Molecular Weight	456.922
MDL Number	MFCD12827991
SMILES	Nc1c(Cl)cc(c2c1OCCO2)c1nn(c(=O)o1)C1CCN(CC1)CCc1ccccc1

5-(8-Amino-7-chloro-2,3-dihydro-1,4-benzodioxin-5-yl)-3-[1-(2-phenylethyl)-4-piperidinyl]-1,3,4-oxadiazol-2(3H)-one is a versatile compound widely used in chemical synthesis. This compound is known for its ability to serve as a key building block in the creation of structurally complex molecules. Its unique molecular structure makes it a valuable intermediate in the preparation of various pharmaceuticals, agrochemicals, and other specialty chemicals. By incorporating this compound into synthetic pathways, chemists can access a diverse array of novel compounds with potential applications in drug discovery, materials science, and other fields.