
Catalog Number	AR0058EG
Chemical Name	Hypothemycin
CAS Number	76958-67-3
Molecular Formula	C19H22O8
Molecular Weight	378.3732
MDL Number	MFCD08457932
SMILES	COc1cc(O)c2c(c1)C(O)C(O)CC1OC1C(=O)C=CCC(OC2=O)C

Hypothemycin is a naturally occurring compound that has found widespread application in chemical synthesis, particularly in the field of medicinal chemistry. This unique compound possesses significant biological activity, making it a valuable tool for developing new pharmaceutical agents. In chemical synthesis, hypothemycin is often used as a key building block or starting material to construct more complex molecules with specific pharmacological properties. Its structural features and reactivity allow for versatile manipulation, enabling chemists to create structurally diverse compounds for drug discovery and development. By incorporating hypothemycin into synthetic routes, researchers can access a wide range of molecular scaffolds that have the potential to exhibit various biological activities, providing new opportunities for the design of novel therapeutic agents.