
Catalog Number	AR005XK6
Chemical Name	3,3,4,4,5,5,5-Heptafluoropentan-1-ol
CAS Number	755-40-8
Molecular Formula	C5H5F7O
Molecular Weight	214.0814
MDL Number	MFCD04039292
SMILES	OCCC(C(C(F)(F)F)(F)F)(F)F

3,3,4,4,5,5,5-Heptafluoro-1-pentanol is a valuable chemical in various chemical synthesis processes due to its unique properties. This compound is commonly utilized as a fluorinating agent in organic chemistry reactions. It serves as a versatile building block for the synthesis of complex organic molecules by introducing fluorine atoms into the target compounds.Additionally, 3,3,4,4,5,5,5-Heptafluoro-1-pentanol is often employed as a solvent or reagent in the production of specialty chemicals, pharmaceutical intermediates, and agrochemicals. Its strong fluorine substituents can enhance the reactivity and selectivity of certain chemical transformations, making it a valuable tool for synthetic chemists working on challenging transformations.Furthermore, this compound has found applications in the development of novel materials, such as fluorinated polymers and surfactants, due to its unique fluorinated structure. Its ability to impart specific properties, such as hydrophobicity and thermal stability, makes it a key component in designing advanced materials for various industrial applications.