
Catalog Number	AR00G4R1
Chemical Name	N-(2-Aminoethyl)-N'-(3',6'-dihydroxy-3-oxospiro[isobenzofuran-1(3H),9'-[9H]xanthen]-5-yl)thiourea
CAS Number	75453-82-6
Molecular Formula	C23H19N3O5S
Molecular Weight	449.47905999999995
MDL Number	MFCD00274154
SMILES	NCCNC(=S)Nc1ccc2c(c1)C(=O)OC12c2ccc(cc2Oc2c1ccc(c2)O)O

The compound N-(2-Aminoethyl)-N'-(3',6'-dihydroxy-3-oxospiro[isobenzofuran-1(3H),9'-[9H]xanthen]-5-yl)thiourea is a versatile reagent in chemical synthesis due to its unique structural properties. It can be employed in various synthetic strategies to introduce functional groups or modify existing molecules. In organic synthesis, this compound can serve as a valuable building block for the construction of complex molecular structures. Its reactive amino and thiol groups allow for the formation of new bonds, enabling the creation of diverse compounds with potentially valuable properties. Additionally, the presence of the spirolactone and xanthenyl moieties in this compound can impart specific characteristics to the synthesized products, making it a valuable tool for designing and synthesizing new molecules with tailored properties.