
Catalog Number	AR008R7Z
Chemical Name	Pyrene, 1,3-dinitro-
CAS Number	75321-20-9
Molecular Formula	C16H8N2O4
Molecular Weight	292.2457
MDL Number	MFCD00010493
SMILES	[O-][N+](=O)c1cc([N+](=O)[O-])c2c3c1ccc1c3c(cc2)ccc1

1,3-Dinitropyrene, a highly reactive compound, has found remarkable applications in chemical synthesis, particularly in the realm of organic chemistry. This versatile molecule serves as a key building block for the creation of various complex organic compounds through a series of carefully controlled reactions. By harnessing the distinctive reactivity of 1,3-Dinitropyrene, chemists can precisely manipulate its chemical structure to introduce specific functional groups and stereochemistry, leading to the synthesis of novel and structurally diverse compounds with potential applications in pharmaceuticals, materials science, and other fields. Additionally, the presence of nitro groups in 1,3-Dinitropyrene imparts unique chemical properties that enable its activation in various transformations, making it a valuable tool for the development of new synthetic methodologies and strategies in organic synthesis.