
Catalog Number	AR005NHB
Chemical Name	Benzene, 1,1'-(chloromethylene)bis[4-methoxy-
CAS Number	7525-23-7
Molecular Formula	C15H15ClO2
Molecular Weight	262.7314
MDL Number	MFCD11974265
SMILES	COc1ccc(cc1)C(c1ccc(cc1)OC)Cl

The compound Benzene, 1,1'-(chloromethylene)bis[4-methoxy- is commonly utilized in chemical synthesis as a versatile building block. Its unique structure allows for the creation of complex molecules through various reactions and functional group manipulations. In synthetic organic chemistry, it serves as a valuable intermediate in the production of pharmaceuticals, agrochemicals, and advanced materials. Due to its reactivity and compatibility with numerous reaction conditions, Benzene, 1,1'-(chloromethylene)bis[4-methoxy- plays a crucial role in the development of novel chemical compounds for a wide range of industrial applications.