
Catalog Number	AR00FANC
Chemical Name	(±)-Molindone
CAS Number	7416-34-4
Molecular Formula	C16H24N2O2
Molecular Weight	276.374
MDL Number	MFCD00866709
SMILES	CCc1c(C)[nH]c2c1C(=O)C(CC2)CN1CCOCC1

(±)-Molindone, a versatile chemical compound, finds significant applications in chemical synthesis processes. This compound plays a crucial role in the production of various pharmaceuticals and agrochemicals due to its unique structural properties. In the field of organic chemistry, (±)-Molindone serves as a key intermediate in the synthesis of complex molecules by facilitating crucial bond formations. Additionally, its reactivity and selectivity make it a valuable tool in the development of novel compounds with potential therapeutic or industrial applications. The use of (±)-Molindone in chemical synthesis highlights its importance in expanding the range of functional molecules that can be efficiently produced in laboratory settings.