
Catalog Number	AR00FBEW
Chemical Name	6''-O-Acetylgenistin
CAS Number	73566-30-0
Molecular Formula	C23H22O11
Molecular Weight	474.4142
MDL Number	MFCD02682937
SMILES	CC(=O)OC[C@H]1O[C@@H](Oc2cc(O)c3c(c2)occ(c3=O)c2ccc(cc2)O)[C@@H]([C@H]([C@@H]1O)O)O

The 6′′-O-Acetylgenistin compound, a derivative of genistin found in soybeans, plays a crucial role in chemical synthesis as a versatile reagent. Its application in organic chemistry extends to serving as a protecting group for hydroxyl functionalities, allowing for selective manipulation of molecules during complex synthesis pathways. Additionally, 6′′-O-Acetylgenistin has the potential to act as a building block in the assembly of more intricate organic structures due to its stability and compatibility with various reaction conditions. Chemists leverage its properties to facilitate the creation of novel compounds with tailored functions and properties.