
Catalog Number	AR005P1J
Chemical Name	3H-Imidazo[4,5-b]pyridine,2-[2-methoxy-4-(methylsulfinyl)phenyl]-
CAS Number	73384-60-8
Molecular Formula	C14H13N3O2S
Molecular Weight	287.3369
MDL Number	MFCD00214085
SMILES	COc1cc(ccc1c1nc2-c(n1)ccc[nH]2)S(=O)C

The compound 2-[2-Methoxy-4-(methylsulfinyl)phenyl]-3H-imidazo[4,5-b]pyridine plays a crucial role in chemical synthesis as a versatile building block. Its unique structure and reactivity make it valuable for the synthesis of various pharmaceuticals, agrochemicals, and materials. This compound can be used as a key intermediate in the preparation of biologically active molecules due to its ability to participate in a variety of synthetic transformations, such as palladium-catalyzed cross-coupling reactions, nucleophilic substitutions, and cyclization reactions. Its presence in the molecular structure imparts desirable properties and characteristics to the final products, making it an essential component in the development of new compounds with diverse applications.