
Catalog Number	AR01JQKQ
Chemical Name	5-bromo-1,3,3-trimethylindol-2-one
CAS Number	72451-22-0
Molecular Formula	C11H12BrNO
Molecular Weight	254.1231
MDL Number	MFCD21908285
SMILES	Brc1ccc2c(c1)C(C)(C)C(=O)N2C

5-Bromo-1,3,3-trimethylindolin-2-one, a versatile chemical compound, plays a crucial role in chemical synthesis as a key building block in the creation of diverse organic molecules. This compound is commonly utilized in the pharmaceutical industry for the development of novel drugs and in the field of material science for the production of advanced materials.In chemical synthesis, 5-Bromo-1,3,3-trimethylindolin-2-one serves as a valuable intermediate for the synthesis of a variety of heterocyclic compounds, which are essential in the design and development of pharmaceuticals, agrochemicals, and functional materials. Its unique structure and reactivity make it a valuable tool in the construction of complex molecular frameworks.Furthermore, the presence of the bromine substituent in this compound allows for further functionalization through various chemical reactions, enabling the synthesis of customized molecules with specific properties and functionalities. This versatility makes 5-Bromo-1,3,3-trimethylindolin-2-one a valuable asset in the toolbox of synthetic chemists for the creation of diverse organic compounds with potential applications in various fields.