
Catalog Number	AR00FE1O
Chemical Name	10-Deacetyl
CAS Number	71629-92-0
Molecular Formula	C29H36O10
Molecular Weight	544.5901
MDL Number	MFCD04448825
SMILES	CC(=O)O[C@@]12CO[C@@H]1C[C@H]([C@@]1([C@@H]2[C@H](OC(=O)c2ccccc2)[C@]2(O)C[C@H](O)C(=C(C2(C)C)[C@H](C1=O)O)C)C)O

7-epi-10-Deacetylbaccatin III is a valuable compound widely used in chemical synthesis for its unique properties and versatile applications. Due to its structural similarity to paclitaxel, a potent anticancer agent derived from Taxus brevifolia, 7-epi-10-Deacetylbaccatin III serves as a key intermediate in the semi-synthesis of paclitaxel and its analogs.In chemical synthesis, 7-epi-10-Deacetylbaccatin III plays a crucial role as a starting material for the production of various paclitaxel derivatives with modified functionalities and improved pharmacological profiles. By selectively modifying specific functional groups on the molecular scaffold of 7-epi-10-Deacetylbaccatin III, chemists can create novel compounds with enhanced therapeutic properties, such as increased solubility, bioavailability, and anticancer activity.Furthermore, the synthetic accessibility and high yield of 7-epi-10-Deacetylbaccatin III make it a cost-effective and efficient precursor for the large-scale production of paclitaxel and its derivatives. Its use in chemical synthesis not only enables the exploration of new drug candidates but also contributes to the development of more affordable therapeutic options for cancer patients.