
Catalog Number	AR00FRN5
Chemical Name	1H-Benzotriazole-5-carboxylicacid,7-amino-,methylester(9CI)
CAS Number	706793-18-2
Molecular Formula	C8H8N4O2
Molecular Weight	192.1747
MDL Number	MFCD18835307
SMILES	COC(=O)c1cc(N)c2c(c1)nn[nH]2

Methyl 7-amino-1H-benzo[d][1,2,3]triazole-5-carboxylate is commonly utilized in chemical synthesis as a versatile building block for the production of various compounds. Its unique structure and reactivity make it an essential component in the synthesis of pharmaceuticals, agrochemicals, and materials. This molecule acts as a key intermediate in the formation of diverse heterocyclic compounds, allowing for the creation of complex structures with specific properties and functions. It serves as a valuable tool for chemists in designing and developing novel molecules with potential applications in a wide range of fields.