
Catalog Number	AR00FAOK
Chemical Name	Ethyl 5,6-dichloro-3,4-dihydro-2(1H)-iminoquinazoline-3-acetate hydrobromide
CAS Number	70381-75-8
Molecular Formula	C12H14BrCl2N3O2
Molecular Weight	383.0685
MDL Number	MFCD12756005
SMILES	CCOC(=O)CN1Cc2c(N=C1N)ccc(c2Cl)Cl.Br

2-Amino-5,6-dichloro-3(4H)-quinazoline Acetic Acid Ethyl Ester Hydrobromide is a versatile compound that finds key applications in chemical synthesis. This compound serves as a valuable building block in the production of pharmaceuticals, agrochemicals, and other fine chemicals. Due to its unique structure and reactivity, it is commonly used in the synthesis of diverse compounds with biological activity. Its incorporation into various chemical reactions allows for the creation of complex molecular structures with potential therapeutic properties. In the field of medicinal chemistry, this compound plays a crucial role in the development of novel drug candidates. Its presence in the synthesis pathway contributes to the design and production of molecules with enhanced pharmacological profiles. Furthermore, the chemical versatility of 2-Amino-5,6-dichloro-3(4H)-quinazoline Acetic Acid Ethyl Ester Hydrobromide enables its utilization in the construction of molecular libraries for drug discovery purposes. By participating in key synthetic transformations, this compound facilitates the efficient and strategic assembly of structurally diverse compounds for further biological evaluation.