
Catalog Number	AR00FOYE
Chemical Name	2-(2,4-Dibromophenoxy)propanoic acid
CAS Number	6965-70-4
Molecular Formula	C9H8Br2O3
Molecular Weight	323.966
MDL Number	MFCD00020404
SMILES	OC(=O)C(Oc1ccc(cc1Br)Br)C

2-(2,4-Dibromophenoxy)propanoic acid is a versatile compound widely used in chemical synthesis for its unique properties and reactivity. As a key building block in organic chemistry, this compound serves as an important intermediate in the synthesis of various pharmaceuticals, agrochemicals, and materials.In chemical synthesis, 2-(2,4-Dibromophenoxy)propanoic acid can be utilized for the formation of complex molecular structures through various reaction pathways. Its bromine substituents make it a valuable starting material for the introduction of functional groups, enabling the synthesis of new chemical entities with desired properties.Moreover, the presence of the phenoxy group in 2-(2,4-Dibromophenoxy)propanoic acid offers opportunities for cross-coupling reactions and further derivatization, leading to the creation of diverse molecules with tailored functions. This compound's versatility and reactivity make it a valuable tool for organic chemists seeking to access novel compounds and advance the field of chemical synthesis.