
Catalog Number	AR00FI67
Chemical Name	BenzenaMine, 4-(1-Methyl-1-phenylethyl)-
CAS Number	6962-10-3
Molecular Formula	C15H17N
Molecular Weight	211.3022
MDL Number	MFCD22493443
SMILES	Nc1ccc(cc1)C(c1ccccc1)(C)C

4-(2-Phenylpropan-2-yl)aniline, also referred to as $name$, serves as a versatile building block in chemical synthesis. Its unique structure containing both a phenyl ring and an alkyl chain provides it with valuable reactivity and functional group compatibility. In the realm of organic chemistry, this compound finds extensive application as a key intermediate in the synthesis of various pharmaceuticals, agrochemicals, and materials.One notable use of 4-(2-Phenylpropan-2-yl)aniline is in the development of novel drug molecules. Its structural features make it an ideal precursor for the introduction of functional groups that are crucial for enhancing the biological activity and pharmacokinetic properties of potential pharmaceutical compounds. Through strategic functionalization and derivatization, chemists can modify this molecule to create new chemical entities with improved potency, selectivity, or solubility for treating a wide range of medical conditions.Furthermore, 4-(2-Phenylpropan-2-yl)aniline plays a significant role in the synthesis of advanced materials. By utilizing its reactivity and versatility, researchers can construct complex molecular architectures that exhibit unique physical and chemical properties. These materials have applications in diverse fields such as optoelectronics, catalysis, and nanotechnology, where precise control over molecular structure is essential for achieving desired performance characteristics.Overall, the strategic incorporation of 4-(2-Phenylpropan-2-yl)aniline into synthetic pathways enables chemists to access a rich space of chemical diversity and functional complexity, leading to the creation of innovative compounds with valuable applications in various industries.