
Catalog Number	AR01FX54
Chemical Name	(1R)-1,2,3,4-Tetrahydro-6-hydroxy-1-[(4-hydroxyphenyl)methyl]-7-methoxy-2,2-dimethylisoquinolinium
CAS Number	6871-67-6
Molecular Formula	C19H24NO3
Molecular Weight	314.3988
MDL Number	MFCD09839013
SMILES	COc1cc2c(cc1O)CC[N+]([C@@H]2Cc1ccc(cc1)O)(C)C

The compound (1R)-1,2,3,4-Tetrahydro-6-hydroxy-1-[(4-hydroxyphenyl)methyl]-7-methoxy-2,2-dimethylisoquinolinium holds significant relevance in chemical synthesis processes. Its unique structure and properties make it a valuable reagent for various reactions, particularly in the realm of asymmetric synthesis. This compound can act as a chiral source, imparting chirality to molecules it interacts with, thereby enabling the selective formation of chiral products. Additionally, (1R)-1,2,3,4-Tetrahydro-6-hydroxy-1-[(4-hydroxyphenyl)methyl]-7-methoxy-2,2-dimethylisoquinolinium can serve as a catalyst for certain transformations, facilitating the synthesis of complex organic compounds with high stereochemical control. Its versatile applications in chemical synthesis underscore its importance in modern organic chemistry research and development.