
Catalog Number	AR00FCCJ
Chemical Name	Butane-1,1,2,2,3,3,4,4-d8, 1,4-dibromo-
CAS Number	68375-92-8
Molecular Formula	C4Br2D8
Molecular Weight	223.9636
MDL Number	MFCD00084134
SMILES	C([2H])(C(C(Br)([2H])[2H])([2H])[2H])(C(Br)([2H])[2H])[2H]

1,4-Dibromobutane-1,1,2,2,3,3,4,4-d8 is a deuterated compound commonly utilized in organic chemical synthesis for various applications. As a selectively deuterated derivative of 1,4-dibromobutane, this compound serves as a valuable tool in labeling studies and nuclear magnetic resonance (NMR) spectroscopy. In chemical synthesis, 1,4-Dibromobutane-1,1,2,2,3,3,4,4-d8 is frequently employed as a precursor in the preparation of deuterium-labeled compounds for mechanistic investigations, metabolic studies, and drug development. The incorporation of deuterium atoms can provide unique insights into reaction mechanisms, molecular dynamics, and stability of organic molecules. Additionally, the use of 1,4-Dibromobutane-1,1,2,2,3,3,4,4-d8 can enhance the resolution and sensitivity of NMR experiments, facilitating the elucidation of complex molecular structures and interactions.