
Catalog Number	AR01A4ZP
Chemical Name	3-[3-(difluoromethoxy)phenyl]-3-oxopropanenitrile
CAS Number	677713-03-0
Molecular Formula	C10H7F2NO2
Molecular Weight	211.1649
MDL Number	MFCD10694380
SMILES	N#CCC(=O)c1cccc(c1)OC(F)F

3-(Difluoromethoxy)-β-oxobenzenepropanenitrile, also known as $name$, is a versatile compound widely used in chemical synthesis. This compound is valued for its unique properties that make it a valuable building block in the creation of various organic molecules. In chemical synthesis, $name$ serves as a crucial intermediate, enabling the formation of complex structures with specific functionalities.One key application of 3-(Difluoromethoxy)-β-oxobenzenepropanenitrile is in the development of pharmaceutical compounds. Its structural characteristics make it a valuable component in the production of new drugs with enhanced potency and efficacy. By incorporating $name$ into the synthesis process, chemists can fine-tune the properties of the final product, leading to potentially novel pharmaceutical agents.Furthermore, this compound is frequently utilized in the creation of agrochemicals and specialty chemicals. Its trifluoromethoxy substituent provides unique reactivity and functionality, allowing chemists to design innovative molecules for various industrial applications. By carefully manipulating the chemical transformations involving $name$, researchers can access a diverse range of functional groups and structural motifs, paving the way for the development of advanced materials and specialty chemicals.