
Catalog Number	AR006FJE
Chemical Name	6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinoline
CAS Number	675576-26-8
Molecular Formula	C15H18BNO2
Molecular Weight	255.1199
MDL Number	MFCD11227091
SMILES	CC1(C)OB(OC1(C)C)c1ccc2c(c1)ccnc2

6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl);isoquinoline is a versatile compound that plays a crucial role in chemical synthesis processes. This compound is commonly utilized as a key building block in the creation of organic molecules and pharmaceutical compounds.Its unique structure and properties make it an invaluable tool for chemists looking to synthesize complex molecules efficiently. The 6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl);isoquinoline moiety serves as a stable and reactive intermediate, enabling the introduction of various functional groups and modifications during synthesis.In chemical synthesis, this compound acts as a powerful coupling partner in cross-coupling reactions, such as Suzuki-Miyaura coupling. By incorporating this compound into the reaction sequence, chemists can achieve precise control over the regioselectivity and stereochemistry of the final product.Additionally, 6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl);isoquinoline is employed in the construction of biologically active molecules, including pharmaceuticals, agrochemicals, and materials for advanced technologies. Its compatibility with a wide range of other reagents and reaction conditions makes it a valuable asset in the synthetic chemist's toolkit.