
Catalog Number	AR01DI8T
Chemical Name	6-bromo-4-nitropyridine-3-carboxylic acid
CAS Number	66092-63-5
Molecular Formula	C6H3BrN2O4
Molecular Weight	247.003
MDL Number	MFCD25965927
SMILES	Brc1ncc(c(c1)[N+](=O)[O-])C(=O)O

6-Bromo-4-Nitronicotinic acid, also known as $name$, plays a crucial role in chemical synthesis as a versatile building block. This compound serves as a key intermediate in the production of various pharmaceuticals, agrochemicals, and specialty chemicals. Its unique structure and reactivity enable it to participate in a diverse range of reactions, allowing for the efficient synthesis of complex organic molecules. $name$ is particularly valued for its ability to introduce specific functional groups into target molecules, enhancing their biological activity or chemical properties. Additionally, its compatibility with a variety of synthetic methodologies makes it a valuable tool for organic chemists seeking to streamline their synthetic routes and improve overall process efficiency. By incorporating 6-Bromo-4-Nitronicotinic acid into their chemical synthesis strategies, researchers can access new possibilities for creating novel compounds with enhanced properties and applications.

tert-Butyl 1-oxa-6-azaspiro[2.5]octane-6-carboxylate

147804-30-6

$4.00/1g, $4.00/250mg, $9.00/5g, $18.00/10g, $43.00/25g, $151.00/100g, $753.00/500g,

Product Details

1H-Indazole, 5-bromo-7-methyl-

156454-43-2

$4.00/250mg, $6.00/1g, $20.00/5g, $39.00/10g, $87.00/25g, $312.00/100g, $727.00/250g, $1,299.00/500g,

Product Details

4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,6-tetrahydropyridine hydrochloride

1121057-75-7

$4.00/100mg, $4.00/250mg, $11.00/1g, $45.00/5g, $78.00/10g, $174.00/25g, $321.00/50g, $606.00/100g,

Product Details

4-Bromo-7-methoxy-6-azaindole

425380-37-6

$17.00/100mg, $34.00/250mg, $47.00/500mg, $66.00/1g, $260.00/5g, $433.00/10g, $866.00/25g, $1,420.00/50g,

Product Details

N,N'-Bis(2,4,6-trimethoxyphenyl)oxalamide

957476-07-2

$7.00/100mg, $14.00/250mg, $49.00/1g, $208.00/5g, $347.00/10g, $693.00/25g, $1,212.00/50g,

Product Details

6-bromo-4-nitropyridine-3-carboxylic acid