
Catalog Number	AR01DUFE
Chemical Name	Morpholine,4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]acetyl]-
CAS Number	656257-49-7
Molecular Formula	C18H26BNO5
Molecular Weight	347.2137399999999
MDL Number	MFCD18379051
SMILES	O=C(N1CCOCC1)COc1ccc(cc1)B1OC(C(O1)(C)C)(C)C

1-Morpholino-2-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy)ethan-1-one serves as a versatile tool in chemical synthesis due to its unique structural properties. This compound plays a crucial role in the formation of boron-containing molecules, which are essential building blocks in various organic reactions. Specifically, it acts as a boron reagent, enabling the introduction of boron functionality into target molecules via cross-coupling reactions. Additionally, the morpholine moiety enhances the compound's solubility and stability characteristics, making it a valuable asset in the development of novel organic compounds with diverse applications.