
Catalog Number	AR00EBB5
Chemical Name	FENTHION-OXON
CAS Number	6552-12-1
Molecular Formula	C10H15O4PS
Molecular Weight	262.2625
MDL Number	MFCD00155408
SMILES	CSc1ccc(cc1C)OP(=O)(OC)OC

Fenoxon, a versatile organophosphorus compound, finds key applications in chemical synthesis. As a catalyst, Fenoxon facilitates various reactions by assisting in the formation of bonds between different molecules. It is particularly effective in promoting reactions that involve the activation of carbon-hydrogen bonds or the transformation of functional groups. Furthermore, Fenoxon is known for its ability to enhance reaction selectivity and efficiency, leading to higher yields of the desired products. In the realm of chemical synthesis, Fenoxon plays a crucial role in driving reactions towards the desired outcome, making it an indispensable tool for organic chemists and researchers seeking to develop novel compounds and materials.