
Catalog Number	AR00ELXE
Chemical Name	N-cyclopropyl-4-MethylbenzenesulfonaMide
CAS Number	65032-46-4
Molecular Formula	C10H13NO2S
Molecular Weight	211.2807
MDL Number	MFCD00551293
SMILES	Cc1ccc(cc1)S(=O)(=O)NC1CC1

The Benzenesulfonamide, N-cyclopropyl-4-methyl- is a versatile compound widely used in chemical synthesis processes.  Its unique structure and properties make it a valuable building block for creating various pharmaceuticals, agrochemicals, and specialty chemicals. This compound serves as a crucial intermediate in the synthesis of diverse organic molecules due to its ability to participate in important chemical reactions such as nucleophilic substitutions and Suzuki coupling reactions. Its cyclopropyl and methyl substituents confer specific steric and electronic effects that play a key role in directing the course of reactions and determining the stereochemistry of the final products. Overall, Benzenesulfonamide, N-cyclopropyl-4-methyl- is an essential tool for synthetic chemists seeking to design and construct complex molecules with precision and efficiency.