
Catalog Number	AR00EJA3
Chemical Name	1-Hexyl-3-methylimidazolium perchlorate
CAS Number	648424-43-5
Molecular Formula	C10H21ClN2O4
Molecular Weight	268.7377400000001
MDL Number	MFCD19440889
SMILES	[O-][Cl](=O)(=O)=O.CCCCCC[NH+]1C=CN(C1)C

1H-Imidazolium, 1-hexyl-3-methyl-, perchlorate is a versatile compound widely used in chemical synthesis due to its unique properties and reactivity. This particular imidazolium salt serves as an efficient catalyst in a variety of organic transformations, including but not limited to, the synthesis of heterocyclic compounds, alkylations, oxidations, and cycloadditions. Its perchlorate counterion enhances its solubility in polar solvents, making it particularly useful in reactions requiring high solubility and stability. Additionally, the long hexyl chain coupled with the methyl group provides enhanced steric effects, leading to increased selectivity and efficiency in various reactions. With its ability to facilitate diverse chemical transformations, 1H-Imidazolium, 1-hexyl-3-methyl-, perchlorate is an indispensable tool in modern organic synthesis.