
Catalog Number	AR00EAPI
Chemical Name	Chrysamine G
CAS Number	6472-91-9
Molecular Formula	C26H18N4O6
Molecular Weight	482.4443
MDL Number	MFCD00045823
SMILES	OC(=O)c1cc(N=Nc2ccc(cc2)c2ccc(cc2)N=Nc2ccc(c(c2)C(=O)O)O)ccc1O

Benzoic acid, 3,3′-[[1,1′-biphenyl]-4,4′-diylbis(2,1-diazenediyl)]bis[6-hydroxy-, sodium salt (1:2) plays a crucial role in chemical synthesis as a versatile reagent. It acts as a key component in the formation of coordination polymers and metal-organic frameworks. The presence of hydroxy groups in this compound enables it to participate in various hydrogen bonding interactions, facilitating the construction of intricate molecular architectures. This sodium salt derivative has found applications in the creation of functional materials with tailored properties, such as porosity, catalytic activity, and selective adsorption capabilities. Additionally, its unique structural features make it a valuable building block in the design of novel molecular scaffolds for advanced materials and pharmaceuticals.