
Catalog Number	AR00EUO2
Chemical Name	1-(2,4-difluorophenyl)-4,4,4-trifluorobutane-1,3-dione
CAS Number	64287-18-9
Molecular Formula	C10H5F5O2
Molecular Weight	252.1375
MDL Number	MFCD11131365
SMILES	Fc1ccc(c(c1)F)C(=O)CC(=O)C(F)(F)F

1,3-Butanedione, 1-(2,4-difluorophenyl)-4,4,4-trifluoro- is a versatile compound that finds extensive application in chemical synthesis. This compound serves as a valuable building block in the creation of various complex organic molecules. Due to its unique structural properties, it acts as a key intermediate in the synthesis of pharmaceuticals, agrochemicals, and specialty chemicals. Its trifluoromethyl and difluorophenyl groups impart specific reactivity and functionality that enable the efficient formation of intricate molecular structures. When utilized in chemical synthesis, 1,3-Butanedione, 1-(2,4-difluorophenyl)-4,4,4-trifluoro- offers chemists a powerful tool for the construction of diverse organic compounds with enhanced properties and potential applications.