
Catalog Number	AR01JIXA
Chemical Name	5-Chloro-2-methoxyphenylboronic acid pinacol ester
CAS Number	635305-45-2
Molecular Formula	C13H18BClO3
Molecular Weight	268.5442
MDL Number	MFCD22414441
SMILES	COc1ccc(cc1B1OC(C(O1)(C)C)(C)C)Cl

5-Chloro-2-methoxyphenylboronic acid pinacol ester is a versatile organic compound commonly utilized in chemical synthesis. This compound is particularly valued for its unique ability to serve as a key building block in the formation of various organic molecules. In organic synthesis, 5-Chloro-2-methoxyphenylboronic acid pinacol ester is often employed as a powerful coupling reagent, facilitating the construction of complex molecular structures through cross-coupling reactions. This compound plays a crucial role in the creation of pharmaceuticals, agrochemicals, and advanced materials, allowing chemists to efficiently access a wide range of functionalized aromatic compounds. Furthermore, the high reactivity and compatibility of 5-Chloro-2-methoxyphenylboronic acid pinacol ester make it a valuable tool in the development of novel chemical entities with diverse applications in the fields of medicinal chemistry and materials science.